C13H15N5 — CID 161004059
2,6-di(pyrazol-1-yl)pyridine;ethane (PubChem CID 161004059) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 2,6-di(pyrazol-1-yl)pyridine;ethane.
| Compound Name | 2,6-di(pyrazol-1-yl)pyridine;ethane |
|---|---|
| PubChem CID | 161004059 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2,6-di(pyrazol-1-yl)pyridine;ethane |
| SMILES | CC.c1cc(-n2cccn2)nc(-n2cccn2)c1 |
| InChI | InChI=1S/C11H9N5.C2H6/c1-4-10(15-8-2-6-12-15)14-11(5-1)16-9-3-7-13-16;1-2/h1-9H;1-2H3 |
| InChIKey | TWGRGXRNMSALNM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |