C11H9CoN5 — CID 175285024
cobalt;2,6-di(pyrazol-1-yl)pyridine (PubChem CID 175285024) has the molecular formula C11H9CoN5 and a molecular weight of 270.16 g/mol. Its IUPAC name is cobalt;2,6-di(pyrazol-1-yl)pyridine.
| Compound Name | cobalt;2,6-di(pyrazol-1-yl)pyridine |
|---|---|
| PubChem CID | 175285024 |
| Molecular Formula | C11H9CoN5 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | cobalt;2,6-di(pyrazol-1-yl)pyridine |
| SMILES | [Co].c1cc(-n2cccn2)nc(-n2cccn2)c1 |
| InChI | InChI=1S/C11H9N5.Co/c1-4-10(15-8-2-6-12-15)14-11(5-1)16-9-3-7-13-16;/h1-9H; |
| InChIKey | CRKKSXXVHQSSAO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |