C20H21N3 — CID 2057498
N,N-diethyl-2,6-diphenylpyrimidin-4-amine (PubChem CID 2057498) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is N,N-diethyl-2,6-diphenylpyrimidin-4-amine.
| Compound Name | N,N-diethyl-2,6-diphenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 2057498 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N,N-diethyl-2,6-diphenylpyrimidin-4-amine |
| SMILES | CCN(CC)c1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N3/c1-3-23(4-2)19-15-18(16-11-7-5-8-12-16)21-20(22-19)17-13-9-6-10-14-17/h5-15H,3-4H2,1-2H3 |
| InChIKey | QIJDRAYUFOYVAT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |