C17H21FN4 — CID 112856201
4-N-cyclohexyl-6-N-[(4-fluorophenyl)methyl]pyrimidine-4,6-diamine (PubChem CID 112856201) has the molecular formula C17H21FN4 and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-N-[(4-fluorophenyl)methyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclohexyl-6-N-[(4-fluorophenyl)methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112856201 |
| Molecular Formula | C17H21FN4 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-N-cyclohexyl-6-N-[(4-fluorophenyl)methyl]pyrimidine-4,6-diamine |
| SMILES | Fc1ccc(CNc2cc(NC3CCCCC3)ncn2)cc1 |
| InChI | InChI=1S/C17H21FN4/c18-14-8-6-13(7-9-14)11-19-16-10-17(21-12-20-16)22-15-4-2-1-3-5-15/h6-10,12,15H,1-5,11H2,(H2,19,20,21,22) |
| InChIKey | YNAGZFIUXQMZRN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |