C17H19N5O — CID 129333914
4-[[[6-[[(3S)-oxan-3-yl]amino]pyrimidin-4-yl]amino]methyl]benzonitrile (PubChem CID 129333914) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[[[6-[[(3S)-oxan-3-yl]amino]pyrimidin-4-yl]amino]methyl]benzonitrile.
| Compound Name | 4-[[[6-[[(3S)-oxan-3-yl]amino]pyrimidin-4-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 129333914 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-[[[6-[[(3S)-oxan-3-yl]amino]pyrimidin-4-yl]amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2cc(N[C@H]3CCCOC3)ncn2)cc1 |
| InChI | InChI=1S/C17H19N5O/c18-9-13-3-5-14(6-4-13)10-19-16-8-17(21-12-20-16)22-15-2-1-7-23-11-15/h3-6,8,12,15H,1-2,7,10-11H2,(H2,19,20,21,22)/t15-/m0/s1 |
| InChIKey | GLILDRWPMVPTTE-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |