C15H16F2N4 — CID 112855977
4-N-cyclopentyl-6-N-(2,4-difluorophenyl)pyrimidine-4,6-diamine (PubChem CID 112855977) has the molecular formula C15H16F2N4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-N-(2,4-difluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-6-N-(2,4-difluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112855977 |
| Molecular Formula | C15H16F2N4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-N-cyclopentyl-6-N-(2,4-difluorophenyl)pyrimidine-4,6-diamine |
| SMILES | Fc1ccc(Nc2cc(NC3CCCC3)ncn2)c(F)c1 |
| InChI | InChI=1S/C15H16F2N4/c16-10-5-6-13(12(17)7-10)21-15-8-14(18-9-19-15)20-11-3-1-2-4-11/h5-9,11H,1-4H2,(H2,18,19,20,21) |
| InChIKey | XTNFDEBLYTWBTN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |