C17H15N3O2 — CID 45106893
1-(1,3-benzodioxol-5-yl)-N-(quinoxalin-6-ylmethyl)methanamine (PubChem CID 45106893) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(quinoxalin-6-ylmethyl)methanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(quinoxalin-6-ylmethyl)methanamine |
|---|---|
| PubChem CID | 45106893 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(quinoxalin-6-ylmethyl)methanamine |
| SMILES | c1cnc2cc(CNCc3ccc4c(c3)OCO4)ccc2n1 |
| InChI | InChI=1S/C17H15N3O2/c1-3-14-15(20-6-5-19-14)7-12(1)9-18-10-13-2-4-16-17(8-13)22-11-21-16/h1-8,18H,9-11H2 |
| InChIKey | CGNVTQUOKKPRKJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |