C14H11N7 — CID 133290976
5-[(2-pyrazol-1-yl-4-pyridinyl)methylamino]pyrazine-2-carbonitrile (PubChem CID 133290976) has the molecular formula C14H11N7 and a molecular weight of 277.29 g/mol. Its IUPAC name is 5-[(2-pyrazol-1-yl-4-pyridinyl)methylamino]pyrazine-2-carbonitrile.
| Compound Name | 5-[(2-pyrazol-1-yl-4-pyridinyl)methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133290976 |
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-[(2-pyrazol-1-yl-4-pyridinyl)methylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(NCc2ccnc(-n3cccn3)c2)cn1 |
| InChI | InChI=1S/C14H11N7/c15-7-12-9-19-13(10-17-12)18-8-11-2-4-16-14(6-11)21-5-1-3-20-21/h1-6,9-10H,8H2,(H,18,19) |
| InChIKey | LSAVXLADWSCOGN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |