C12H9ClN4 — CID 63658175
5-[(3-chlorophenyl)methylamino]pyrazine-2-carbonitrile (PubChem CID 63658175) has the molecular formula C12H9ClN4 and a molecular weight of 244.69 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylamino]pyrazine-2-carbonitrile.
| Compound Name | 5-[(3-chlorophenyl)methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 63658175 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-[(3-chlorophenyl)methylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(NCc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C12H9ClN4/c13-10-3-1-2-9(4-10)6-16-12-8-15-11(5-14)7-17-12/h1-4,7-8H,6H2,(H,16,17) |
| InChIKey | VLDQJUXSUOMRGB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |