C15H7ClF2N4 — CID 69183763
4-(4-chloro-3-fluoroanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile (PubChem CID 69183763) has the molecular formula C15H7ClF2N4 and a molecular weight of 316.70 g/mol. Its IUPAC name is 4-(4-chloro-3-fluoroanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 4-(4-chloro-3-fluoroanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 69183763 |
| Molecular Formula | C15H7ClF2N4 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-(4-chloro-3-fluoroanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cnc2cnc(F)cc2c1Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H7ClF2N4/c16-11-2-1-9(3-12(11)17)22-15-8(5-19)6-20-13-7-21-14(18)4-10(13)15/h1-4,6-7H,(H,20,22) |
| InChIKey | HXCQYVUZKIRAMC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|