C15H8FIN4 — CID 69180760
6-fluoro-4-(3-iodoanilino)-1,7-naphthyridine-3-carbonitrile (PubChem CID 69180760) has the molecular formula C15H8FIN4 and a molecular weight of 390.16 g/mol. Its IUPAC name is 6-fluoro-4-(3-iodoanilino)-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 6-fluoro-4-(3-iodoanilino)-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 69180760 |
| Molecular Formula | C15H8FIN4 |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 6-fluoro-4-(3-iodoanilino)-1,7-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cnc2cnc(F)cc2c1Nc1cccc(I)c1 |
| InChI | InChI=1S/C15H8FIN4/c16-14-5-12-13(8-20-14)19-7-9(6-18)15(12)21-11-3-1-2-10(17)4-11/h1-5,7-8H,(H,19,21) |
| InChIKey | JEROMYKCTQYJOI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|