C19H13ClN4 — CID 133310729
6-chloro-4-[1-(4-cyanophenyl)ethylamino]quinoline-3-carbonitrile (PubChem CID 133310729) has the molecular formula C19H13ClN4 and a molecular weight of 332.79 g/mol. Its IUPAC name is 6-chloro-4-[1-(4-cyanophenyl)ethylamino]quinoline-3-carbonitrile.
| Compound Name | 6-chloro-4-[1-(4-cyanophenyl)ethylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133310729 |
| Molecular Formula | C19H13ClN4 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 6-chloro-4-[1-(4-cyanophenyl)ethylamino]quinoline-3-carbonitrile |
| SMILES | CC(Nc1c(C#N)cnc2ccc(Cl)cc12)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H13ClN4/c1-12(14-4-2-13(9-21)3-5-14)24-19-15(10-22)11-23-18-7-6-16(20)8-17(18)19/h2-8,11-12H,1H3,(H,23,24) |
| InChIKey | GTFVMBDZNAGCEB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |