C23H20N6 — CID 177022545
6-(5,6-diamino-3-pyridinyl)-4-(1-phenylethylamino)quinoline-3-carbonitrile (PubChem CID 177022545) has the molecular formula C23H20N6 and a molecular weight of 380.46 g/mol. Its IUPAC name is 6-(5,6-diamino-3-pyridinyl)-4-(1-phenylethylamino)quinoline-3-carbonitrile.
| Compound Name | 6-(5,6-diamino-3-pyridinyl)-4-(1-phenylethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177022545 |
| Molecular Formula | C23H20N6 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-(5,6-diamino-3-pyridinyl)-4-(1-phenylethylamino)quinoline-3-carbonitrile |
| SMILES | CC(Nc1c(C#N)cnc2ccc(-c3cnc(N)c(N)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C23H20N6/c1-14(15-5-3-2-4-6-15)29-22-18(11-24)13-27-21-8-7-16(9-19(21)22)17-10-20(25)23(26)28-12-17/h2-10,12-14H,25H2,1H3,(H2,26,28)(H,27,29) |
| InChIKey | NFVANPRKBZHMTQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |