C23H18N4O — CID 170565419
6-(5-hydroxy-3-pyridinyl)-4-(2-phenylethylamino)quinoline-3-carbonitrile (PubChem CID 170565419) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is 6-(5-hydroxy-3-pyridinyl)-4-(2-phenylethylamino)quinoline-3-carbonitrile.
| Compound Name | 6-(5-hydroxy-3-pyridinyl)-4-(2-phenylethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 170565419 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 6-(5-hydroxy-3-pyridinyl)-4-(2-phenylethylamino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(-c3cncc(O)c3)cc2c1NCCc1ccccc1 |
| InChI | InChI=1S/C23H18N4O/c24-12-19-14-27-22-7-6-17(18-10-20(28)15-25-13-18)11-21(22)23(19)26-9-8-16-4-2-1-3-5-16/h1-7,10-11,13-15,28H,8-9H2,(H,26,27) |
| InChIKey | TYXQWHVBYNJPKW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |