C19H18N4 — CID 166360530
4-[2-(4-ethylphenyl)ethylamino]-1,7-naphthyridine-3-carbonitrile (PubChem CID 166360530) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)ethylamino]-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 4-[2-(4-ethylphenyl)ethylamino]-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166360530 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[2-(4-ethylphenyl)ethylamino]-1,7-naphthyridine-3-carbonitrile |
| SMILES | CCc1ccc(CCNc2c(C#N)cnc3cnccc23)cc1 |
| InChI | InChI=1S/C19H18N4/c1-2-14-3-5-15(6-4-14)7-10-22-19-16(11-20)12-23-18-13-21-9-8-17(18)19/h3-6,8-9,12-13H,2,7,10H2,1H3,(H,22,23) |
| InChIKey | WGCDELTWDONTGF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |