C23H17ClFN5O2S — CID 171341562
N-[2-chloro-5-[3-cyano-4-[(3-fluorophenyl)methylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 171341562) has the molecular formula C23H17ClFN5O2S and a molecular weight of 481.94 g/mol. Its IUPAC name is N-[2-chloro-5-[3-cyano-4-[(3-fluorophenyl)methylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[3-cyano-4-[(3-fluorophenyl)methylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 171341562 |
| Molecular Formula | C23H17ClFN5O2S |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | N-[2-chloro-5-[3-cyano-4-[(3-fluorophenyl)methylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(-c2ccc3ncc(C#N)c(NCc4cccc(F)c4)c3c2)cnc1Cl |
| InChI | InChI=1S/C23H17ClFN5O2S/c1-33(31,32)30-21-9-16(12-29-23(21)24)15-5-6-20-19(8-15)22(17(10-26)13-27-20)28-11-14-3-2-4-18(25)7-14/h2-9,12-13,30H,11H2,1H3,(H,27,28) |
| InChIKey | LBXYYNFFAXDARR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|