C25H20ClN5O2S — CID 177022549
N-[2-chloro-5-[3-cyano-4-[(3-phenyloxetan-3-yl)amino]quinolin-6-yl]-3-pyridinyl]methanesulfinamide (PubChem CID 177022549) has the molecular formula C25H20ClN5O2S and a molecular weight of 489.99 g/mol. Its IUPAC name is N-[2-chloro-5-[3-cyano-4-[(3-phenyloxetan-3-yl)amino]quinolin-6-yl]-3-pyridinyl]methanesulfinamide.
| Compound Name | N-[2-chloro-5-[3-cyano-4-[(3-phenyloxetan-3-yl)amino]quinolin-6-yl]-3-pyridinyl]methanesulfinamide |
|---|---|
| PubChem CID | 177022549 |
| Molecular Formula | C25H20ClN5O2S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-[2-chloro-5-[3-cyano-4-[(3-phenyloxetan-3-yl)amino]quinolin-6-yl]-3-pyridinyl]methanesulfinamide |
| SMILES | CS(=O)Nc1cc(-c2ccc3ncc(C#N)c(NC4(c5ccccc5)COC4)c3c2)cnc1Cl |
| InChI | InChI=1S/C25H20ClN5O2S/c1-34(32)31-22-10-17(12-29-24(22)26)16-7-8-21-20(9-16)23(18(11-27)13-28-21)30-25(14-33-15-25)19-5-3-2-4-6-19/h2-10,12-13,31H,14-15H2,1H3,(H,28,30) |
| InChIKey | DZBCEAMPWUSXPC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|