C24H19ClFN5O2S — CID 164809102
N-[2-chloro-5-[3-cyano-4-[1-(2-fluorophenyl)ethylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 164809102) has the molecular formula C24H19ClFN5O2S and a molecular weight of 495.97 g/mol. Its IUPAC name is N-[2-chloro-5-[3-cyano-4-[1-(2-fluorophenyl)ethylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[3-cyano-4-[1-(2-fluorophenyl)ethylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 164809102 |
| Molecular Formula | C24H19ClFN5O2S |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-[2-chloro-5-[3-cyano-4-[1-(2-fluorophenyl)ethylamino]quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | CC(Nc1c(C#N)cnc2ccc(-c3cnc(Cl)c(NS(C)(=O)=O)c3)cc12)c1ccccc1F |
| InChI | InChI=1S/C24H19ClFN5O2S/c1-14(18-5-3-4-6-20(18)26)30-23-17(11-27)13-28-21-8-7-15(9-19(21)23)16-10-22(24(25)29-12-16)31-34(2,32)33/h3-10,12-14,31H,1-2H3,(H,28,30) |
| InChIKey | QNQZECZZGUFCFM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|