C21H13Cl2FN6O2S — CID 137370797
N-[2-chloro-5-[8-(3-chloro-4-fluoroanilino)-7-cyano-1,5-naphthyridin-2-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 137370797) has the molecular formula C21H13Cl2FN6O2S and a molecular weight of 503.35 g/mol. Its IUPAC name is N-[2-chloro-5-[8-(3-chloro-4-fluoroanilino)-7-cyano-1,5-naphthyridin-2-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[8-(3-chloro-4-fluoroanilino)-7-cyano-1,5-naphthyridin-2-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 137370797 |
| Molecular Formula | C21H13Cl2FN6O2S |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | N-[2-chloro-5-[8-(3-chloro-4-fluoroanilino)-7-cyano-1,5-naphthyridin-2-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(-c2ccc3ncc(C#N)c(Nc4ccc(F)c(Cl)c4)c3n2)cnc1Cl |
| InChI | InChI=1S/C21H13Cl2FN6O2S/c1-33(31,32)30-18-6-11(9-27-21(18)23)16-4-5-17-20(29-16)19(12(8-25)10-26-17)28-13-2-3-15(24)14(22)7-13/h2-7,9-10,30H,1H3,(H,26,28) |
| InChIKey | AGWKISAWBDBSOP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|