C25H22N4O5 — CID 140638548
4-[[3-[[2-(2-hydroxyethoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid (PubChem CID 140638548) has the molecular formula C25H22N4O5 and a molecular weight of 458.47 g/mol. Its IUPAC name is 4-[[3-[[2-(2-hydroxyethoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid.
| Compound Name | 4-[[3-[[2-(2-hydroxyethoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 140638548 |
| Molecular Formula | C25H22N4O5 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 4-[[3-[[2-(2-hydroxyethoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid |
| SMILES | O=C(Nc1cccc(CNc2ncnc3c(C(=O)O)cccc23)c1)c1ccccc1OCCO |
| InChI | InChI=1S/C25H22N4O5/c30-11-12-34-21-10-2-1-7-18(21)24(31)29-17-6-3-5-16(13-17)14-26-23-19-8-4-9-20(25(32)33)22(19)27-15-28-23/h1-10,13,15,30H,11-12,14H2,(H,29,31)(H,32,33)(H,26,27,28) |
| InChIKey | ZBOYRBGFZVAEIS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |