C27H27N5O4 — CID 66763383
4-[[3-[[3-(3-methoxypropoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide (PubChem CID 66763383) has the molecular formula C27H27N5O4 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[[3-[[3-(3-methoxypropoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide.
| Compound Name | 4-[[3-[[3-(3-methoxypropoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 66763383 |
| Molecular Formula | C27H27N5O4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 4-[[3-[[3-(3-methoxypropoxy)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide |
| SMILES | COCCCOc1cccc(C(=O)Nc2cccc(CNc3ncnc4c(C(N)=O)cccc34)c2)c1 |
| InChI | InChI=1S/C27H27N5O4/c1-35-12-5-13-36-21-9-3-7-19(15-21)27(34)32-20-8-2-6-18(14-20)16-29-26-23-11-4-10-22(25(28)33)24(23)30-17-31-26/h2-4,6-11,14-15,17H,5,12-13,16H2,1H3,(H2,28,33)(H,32,34)(H,29,30,31) |
| InChIKey | RJMNXYGYOBERFT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|