C26H21N7O2 — CID 66763542
4-[[3-[[4-(1H-imidazol-2-yl)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide (PubChem CID 66763542) has the molecular formula C26H21N7O2 and a molecular weight of 463.50 g/mol. Its IUPAC name is 4-[[3-[[4-(1H-imidazol-2-yl)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide.
| Compound Name | 4-[[3-[[4-(1H-imidazol-2-yl)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 66763542 |
| Molecular Formula | C26H21N7O2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 4-[[3-[[4-(1H-imidazol-2-yl)benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxamide |
| SMILES | NC(=O)c1cccc2c(NCc3cccc(NC(=O)c4ccc(-c5ncc[nH]5)cc4)c3)ncnc12 |
| InChI | InChI=1S/C26H21N7O2/c27-23(34)20-5-2-6-21-22(20)31-15-32-25(21)30-14-16-3-1-4-19(13-16)33-26(35)18-9-7-17(8-10-18)24-28-11-12-29-24/h1-13,15H,14H2,(H2,27,34)(H,28,29)(H,33,35)(H,30,31,32) |
| InChIKey | JYUQCOURFHGOMR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |