C15H22N4O3S — CID 142434981
5-N-[(2,4-dimethoxyphenyl)methyl]-3-N-(3-methoxypropyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 142434981) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 5-N-[(2,4-dimethoxyphenyl)methyl]-3-N-(3-methoxypropyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-[(2,4-dimethoxyphenyl)methyl]-3-N-(3-methoxypropyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 142434981 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-N-[(2,4-dimethoxyphenyl)methyl]-3-N-(3-methoxypropyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | COCCCNc1nsc(NCc2ccc(OC)cc2OC)n1 |
| InChI | InChI=1S/C15H22N4O3S/c1-20-8-4-7-16-14-18-15(23-19-14)17-10-11-5-6-12(21-2)9-13(11)22-3/h5-6,9H,4,7-8,10H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | JZSHLNXWASDCLZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|