C25H28BN3O4S — CID 144912692
N-[(2,4-dimethoxyphenyl)methyl]-3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-amine;phenylboronic acid (PubChem CID 144912692) has the molecular formula C25H28BN3O4S and a molecular weight of 477.40 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-amine;phenylboronic acid.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-amine;phenylboronic acid |
|---|---|
| PubChem CID | 144912692 |
| Molecular Formula | C25H28BN3O4S |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-amine;phenylboronic acid |
| SMILES | COc1ccc(CNc2nc(Cc3ccc(C)cc3)ns2)c(OC)c1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O2S.C6H7BO2/c1-13-4-6-14(7-5-13)10-18-21-19(25-22-18)20-12-15-8-9-16(23-2)11-17(15)24-3;8-7(9)6-4-2-1-3-5-6/h4-9,11H,10,12H2,1-3H3,(H,20,21,22);1-5,8-9H |
| InChIKey | IHJUPIIXROGQHQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|