About 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol
1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol (PubChem CID 115691842) has the molecular formula C10H18N2OS
and a molecular weight of 214.33 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol.
Molecular Properties
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol |
| PubChem CID | 115691842 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol |
| SMILES | CCCC(O)CNc1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H18N2OS/c1-4-5-9(13)6-11-10-12-7(2)8(3)14-10/h9,13H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | TZFCMNOGPBAYLT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol?
The IUPAC name of 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol (CID 115691842) is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol.
What is the SMILES notation for 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol?
The canonical SMILES for 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol is CCCC(O)CNc1nc(C)c(C)s1.
What is the InChIKey of 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol?
The InChIKey is TZFCMNOGPBAYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2OS/c1-4-5-9(13)6-11-10-12-7(2)8(3)14-10/h9,13H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol?
1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol has a molecular weight of 214.33 g/mol, XLogP of 2.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pentan-2-ol is sourced from PubChem (CID 115691842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).