C24H45N3S — CID 118403524
4,5-dimethyl-N-[(E)-3-octylundecan-2-ylideneamino]-1,3-thiazol-2-amine (PubChem CID 118403524) has the molecular formula C24H45N3S and a molecular weight of 407.71 g/mol. Its IUPAC name is 4,5-dimethyl-N-[(E)-3-octylundecan-2-ylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4,5-dimethyl-N-[(E)-3-octylundecan-2-ylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 118403524 |
| Molecular Formula | C24H45N3S |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 407.33 |
| IUPAC Name | 4,5-dimethyl-N-[(E)-3-octylundecan-2-ylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCC(CCCCCCCC)/C(C)=N/Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C24H45N3S/c1-6-8-10-12-14-16-18-23(19-17-15-13-11-9-7-2)21(4)26-27-24-25-20(3)22(5)28-24/h23H,6-19H2,1-5H3,(H,25,27)/b26-21+ |
| InChIKey | GUWVVJOXHIFWKV-YYADALCUSA-N |
| XLogP | 8.67 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|