C15H18N4S — CID 115708583
N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-pyrazol-1-ylpropan-1-amine (PubChem CID 115708583) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-pyrazol-1-ylpropan-1-amine.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-pyrazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 115708583 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-pyrazol-1-ylpropan-1-amine |
| SMILES | CC(NCCCn1cccn1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H18N4S/c1-12(16-8-4-10-19-11-5-9-17-19)15-18-13-6-2-3-7-14(13)20-15/h2-3,5-7,9,11-12,16H,4,8,10H2,1H3 |
| InChIKey | DOMNSVYPJFQNCP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|