C17H22N4S — CID 97232749
N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-1-amine (PubChem CID 97232749) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-1-amine.
| Compound Name | N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 97232749 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-4-(2-methylimidazol-1-yl)butan-1-amine |
| SMILES | Cc1nccn1CCCCN[C@H](C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H22N4S/c1-13(17-20-15-7-3-4-8-16(15)22-17)18-9-5-6-11-21-12-10-19-14(21)2/h3-4,7-8,10,12-13,18H,5-6,9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | KQFMKISPPPKERI-CYBMUJFWSA-N |
| XLogP | 3.93 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|