C12H21N2O3P — CID 10730873
2-N-(2-diethoxyphosphorylethyl)benzene-1,2-diamine (PubChem CID 10730873) has the molecular formula C12H21N2O3P and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-N-(2-diethoxyphosphorylethyl)benzene-1,2-diamine.
| Compound Name | 2-N-(2-diethoxyphosphorylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 10730873 |
| Molecular Formula | C12H21N2O3P |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-N-(2-diethoxyphosphorylethyl)benzene-1,2-diamine |
| SMILES | CCOP(=O)(CCNc1ccccc1N)OCC |
| InChI | InChI=1S/C12H21N2O3P/c1-3-16-18(15,17-4-2)10-9-14-12-8-6-5-7-11(12)13/h5-8,14H,3-4,9-10,13H2,1-2H3 |
| InChIKey | YAJYMUSNGDYGSC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|