C18H30NO3P — CID 163740365
N-(2-diethoxyphosphorylethyl)-2-(2,3-dimethylbut-3-en-2-yl)aniline (PubChem CID 163740365) has the molecular formula C18H30NO3P and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(2-diethoxyphosphorylethyl)-2-(2,3-dimethylbut-3-en-2-yl)aniline.
| Compound Name | N-(2-diethoxyphosphorylethyl)-2-(2,3-dimethylbut-3-en-2-yl)aniline |
|---|---|
| PubChem CID | 163740365 |
| Molecular Formula | C18H30NO3P |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-(2-diethoxyphosphorylethyl)-2-(2,3-dimethylbut-3-en-2-yl)aniline |
| SMILES | C=C(C)C(C)(C)c1ccccc1NCCP(=O)(OCC)OCC |
| InChI | InChI=1S/C18H30NO3P/c1-7-21-23(20,22-8-2)14-13-19-17-12-10-9-11-16(17)18(5,6)15(3)4/h9-12,19H,3,7-8,13-14H2,1-2,4-6H3 |
| InChIKey | LHEVXBDDSFPLFA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|