C17H22N3O4P — CID 59805822
N-(2-diethoxyphosphorylethyl)-2-phenylpyrimidine-5-carboxamide (PubChem CID 59805822) has the molecular formula C17H22N3O4P and a molecular weight of 363.35 g/mol. Its IUPAC name is N-(2-diethoxyphosphorylethyl)-2-phenylpyrimidine-5-carboxamide.
| Compound Name | N-(2-diethoxyphosphorylethyl)-2-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59805822 |
| Molecular Formula | C17H22N3O4P |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-(2-diethoxyphosphorylethyl)-2-phenylpyrimidine-5-carboxamide |
| SMILES | CCOP(=O)(CCNC(=O)c1cnc(-c2ccccc2)nc1)OCC |
| InChI | InChI=1S/C17H22N3O4P/c1-3-23-25(22,24-4-2)11-10-18-17(21)15-12-19-16(20-13-15)14-8-6-5-7-9-14/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,18,21) |
| InChIKey | OWSYOIFQSLZUOF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|