C17H27O5P — CID 14785365
(3R,4R)-3-[di(propan-2-yloxy)phosphorylmethyl]-4-hydroxy-4-phenylbutan-2-one (PubChem CID 14785365) has the molecular formula C17H27O5P and a molecular weight of 342.37 g/mol. Its IUPAC name is (3R,4R)-3-[di(propan-2-yloxy)phosphorylmethyl]-4-hydroxy-4-phenylbutan-2-one.
| Compound Name | (3R,4R)-3-[di(propan-2-yloxy)phosphorylmethyl]-4-hydroxy-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 14785365 |
| Molecular Formula | C17H27O5P |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (3R,4R)-3-[di(propan-2-yloxy)phosphorylmethyl]-4-hydroxy-4-phenylbutan-2-one |
| SMILES | CC(=O)[C@H](CP(=O)(OC(C)C)OC(C)C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H27O5P/c1-12(2)21-23(20,22-13(3)4)11-16(14(5)18)17(19)15-9-7-6-8-10-15/h6-10,12-13,16-17,19H,11H2,1-5H3/t16-,17-/m0/s1 |
| InChIKey | JHKWSNREURGVSP-IRXDYDNUSA-N |
| XLogP | 3.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|