C19H19Cl3N2O7 — CID 67938179
3-(chloromethyl)benzoic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide (PubChem CID 67938179) has the molecular formula C19H19Cl3N2O7 and a molecular weight of 493.73 g/mol. Its IUPAC name is 3-(chloromethyl)benzoic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide.
| Compound Name | 3-(chloromethyl)benzoic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 67938179 |
| Molecular Formula | C19H19Cl3N2O7 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 3-(chloromethyl)benzoic acid;2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| SMILES | O=C(N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1)C(Cl)Cl.O=C(O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O5.C8H7ClO2/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20;9-5-6-2-1-3-7(4-6)8(10)11/h1-4,8-10,16-17H,5H2,(H,14,18);1-4H,5H2,(H,10,11)/t8-,9-;/m1./s1 |
| InChIKey | GUYBGVJHWWHGNT-VTLYIQCISA-N |
| XLogP | 3.03 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|