C13H18FNO3S2 — CID 19422981
N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanethioamide (PubChem CID 19422981) has the molecular formula C13H18FNO3S2 and a molecular weight of 319.42 g/mol. Its IUPAC name is N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanethioamide.
| Compound Name | N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanethioamide |
|---|---|
| PubChem CID | 19422981 |
| Molecular Formula | C13H18FNO3S2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanethioamide |
| SMILES | CCC(=S)NC(CF)C(O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H18FNO3S2/c1-3-12(19)15-11(8-14)13(16)9-4-6-10(7-5-9)20(2,17)18/h4-7,11,13,16H,3,8H2,1-2H3,(H,15,19) |
| InChIKey | LNGULNVIDSXPRX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|