C19H22FNO6S — CID 123233229
3-(3,4-dihydroxyphenyl)-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanamide (PubChem CID 123233229) has the molecular formula C19H22FNO6S and a molecular weight of 411.45 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 123233229 |
| Molecular Formula | C19H22FNO6S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]propanamide |
| SMILES | CS(=O)(=O)c1ccc(C(O)C(CF)NC(=O)CCc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C19H22FNO6S/c1-28(26,27)14-6-4-13(5-7-14)19(25)15(11-20)21-18(24)9-3-12-2-8-16(22)17(23)10-12/h2,4-8,10,15,19,22-23,25H,3,9,11H2,1H3,(H,21,24) |
| InChIKey | XWDGSKMQENQYAE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|