C9H12NO4S- — CID 70916925
4-[(1R,2R)-2-amino-1,3-dihydroxypropyl]benzenesulfinate (PubChem CID 70916925) has the molecular formula C9H12NO4S- and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-[(1R,2R)-2-amino-1,3-dihydroxypropyl]benzenesulfinate.
| Compound Name | 4-[(1R,2R)-2-amino-1,3-dihydroxypropyl]benzenesulfinate |
|---|---|
| PubChem CID | 70916925 |
| Molecular Formula | C9H12NO4S- |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 4-[(1R,2R)-2-amino-1,3-dihydroxypropyl]benzenesulfinate |
| SMILES | N[C@H](CO)[C@H](O)c1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C9H13NO4S/c10-8(5-11)9(12)6-1-3-7(4-2-6)15(13)14/h1-4,8-9,11-12H,5,10H2,(H,13,14)/p-1/t8-,9-/m1/s1 |
| InChIKey | HIRBQLLAIVBPIJ-RKDXNWHRSA-M |
| XLogP | -0.72 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|