C12H19NO2S — CID 104681326
5-amino-2-[(5-ethylthiophen-2-yl)methyl]pentanoic acid (PubChem CID 104681326) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 5-amino-2-[(5-ethylthiophen-2-yl)methyl]pentanoic acid.
| Compound Name | 5-amino-2-[(5-ethylthiophen-2-yl)methyl]pentanoic acid |
|---|---|
| PubChem CID | 104681326 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-amino-2-[(5-ethylthiophen-2-yl)methyl]pentanoic acid |
| SMILES | CCc1ccc(CC(CCCN)C(=O)O)s1 |
| InChI | InChI=1S/C12H19NO2S/c1-2-10-5-6-11(16-10)8-9(12(14)15)4-3-7-13/h5-6,9H,2-4,7-8,13H2,1H3,(H,14,15) |
| InChIKey | DQWUCHHQNYMIDY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |