C13H20OS — CID 63892354
1-(5-ethylthiophen-2-yl)-4,4-dimethylpentan-2-one (PubChem CID 63892354) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-4,4-dimethylpentan-2-one.
| Compound Name | 1-(5-ethylthiophen-2-yl)-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 63892354 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-4,4-dimethylpentan-2-one |
| SMILES | CCc1ccc(CC(=O)CC(C)(C)C)s1 |
| InChI | InChI=1S/C13H20OS/c1-5-11-6-7-12(15-11)8-10(14)9-13(2,3)4/h6-7H,5,8-9H2,1-4H3 |
| InChIKey | HOSHTIWQSGVTCP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |