C12H18BrNOS — CID 116608350
4-amino-1-(5-bromothiophen-2-yl)-5,5-dimethylhexan-2-one (PubChem CID 116608350) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is 4-amino-1-(5-bromothiophen-2-yl)-5,5-dimethylhexan-2-one.
| Compound Name | 4-amino-1-(5-bromothiophen-2-yl)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 116608350 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 4-amino-1-(5-bromothiophen-2-yl)-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)C(N)CC(=O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C12H18BrNOS/c1-12(2,3)10(14)7-8(15)6-9-4-5-11(13)16-9/h4-5,10H,6-7,14H2,1-3H3 |
| InChIKey | MFVOCKUUOHNPRI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |