C13H19ClN2O — CID 116608406
4-amino-1-(3-chloro-4-pyridinyl)-5,5-dimethylhexan-2-one (PubChem CID 116608406) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 4-amino-1-(3-chloro-4-pyridinyl)-5,5-dimethylhexan-2-one.
| Compound Name | 4-amino-1-(3-chloro-4-pyridinyl)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 116608406 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-amino-1-(3-chloro-4-pyridinyl)-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)C(N)CC(=O)Cc1ccncc1Cl |
| InChI | InChI=1S/C13H19ClN2O/c1-13(2,3)12(15)7-10(17)6-9-4-5-16-8-11(9)14/h4-5,8,12H,6-7,15H2,1-3H3 |
| InChIKey | FLWHNYXVLKBZGB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |