C13H21N3O — CID 116608441
4-amino-1-(4-amino-3-pyridinyl)-5,5-dimethylhexan-2-one (PubChem CID 116608441) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-amino-1-(4-amino-3-pyridinyl)-5,5-dimethylhexan-2-one.
| Compound Name | 4-amino-1-(4-amino-3-pyridinyl)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 116608441 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 4-amino-1-(4-amino-3-pyridinyl)-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)C(N)CC(=O)Cc1cnccc1N |
| InChI | InChI=1S/C13H21N3O/c1-13(2,3)12(15)7-10(17)6-9-8-16-5-4-11(9)14/h4-5,8,12H,6-7,15H2,1-3H3,(H2,14,16) |
| InChIKey | AEUCORZUWVQVKS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |