About 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine
4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine (PubChem CID 91468234) has the molecular formula C12H24N4S
and a molecular weight of 256.42 g/mol. Its IUPAC name is 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine.
Molecular Properties
| Compound Name | 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine |
| PubChem CID | 91468234 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine |
| SMILES | NCCC(N)Cc1ccc(CC(N)CCN)s1 |
| InChI | InChI=1S/C12H24N4S/c13-5-3-9(15)7-11-1-2-12(17-11)8-10(16)4-6-14/h1-2,9-10H,3-8,13-16H2 |
| InChIKey | GMXAWEGIGFRSQD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine?
The IUPAC name of 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine (CID 91468234) is 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine.
What is the SMILES notation for 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine?
The canonical SMILES for 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine is NCCC(N)Cc1ccc(CC(N)CCN)s1.
What is the InChIKey of 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine?
The InChIKey is GMXAWEGIGFRSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4S/c13-5-3-9(15)7-11-1-2-12(17-11)8-10(16)4-6-14/h1-2,9-10H,3-8,13-16H2.
What are the key properties of 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine?
4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine has a molecular weight of 256.42 g/mol, XLogP of 0.19, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine is sourced from PubChem (CID 91468234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).