C12H24N4S — CID 91468234
4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine (PubChem CID 91468234) has the molecular formula C12H24N4S and a molecular weight of 256.42 g/mol. Its IUPAC name is 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine.
| Compound Name | 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine |
|---|---|
| PubChem CID | 91468234 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-[5-(2,4-diaminobutyl)thiophen-2-yl]butane-1,3-diamine |
| SMILES | NCCC(N)Cc1ccc(CC(N)CCN)s1 |
| InChI | InChI=1S/C12H24N4S/c13-5-3-9(15)7-11-1-2-12(17-11)8-10(16)4-6-14/h1-2,9-10H,3-8,13-16H2 |
| InChIKey | GMXAWEGIGFRSQD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |