C15H14ClF2NS — CID 66145347
1-(4-chlorophenyl)sulfanyl-3-(2,4-difluorophenyl)propan-2-amine (PubChem CID 66145347) has the molecular formula C15H14ClF2NS and a molecular weight of 313.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfanyl-3-(2,4-difluorophenyl)propan-2-amine.
| Compound Name | 1-(4-chlorophenyl)sulfanyl-3-(2,4-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 66145347 |
| Molecular Formula | C15H14ClF2NS |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-(4-chlorophenyl)sulfanyl-3-(2,4-difluorophenyl)propan-2-amine |
| SMILES | NC(CSc1ccc(Cl)cc1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H14ClF2NS/c16-11-2-5-14(6-3-11)20-9-13(19)7-10-1-4-12(17)8-15(10)18/h1-6,8,13H,7,9,19H2 |
| InChIKey | HLIWEYRRIPBQLW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |