C15H14ClF2N — CID 79442407
2-(4-chlorophenyl)-3-(2,4-difluorophenyl)propan-1-amine (PubChem CID 79442407) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2,4-difluorophenyl)propan-1-amine.
| Compound Name | 2-(4-chlorophenyl)-3-(2,4-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 79442407 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2,4-difluorophenyl)propan-1-amine |
| SMILES | NCC(Cc1ccc(F)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClF2N/c16-13-4-1-10(2-5-13)12(9-19)7-11-3-6-14(17)8-15(11)18/h1-6,8,12H,7,9,19H2 |
| InChIKey | VOMXFSHMEPSSLD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |