C18H19BrClNO2 — CID 66535212
N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine (PubChem CID 66535212) has the molecular formula C18H19BrClNO2 and a molecular weight of 396.71 g/mol. Its IUPAC name is N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 66535212 |
| Molecular Formula | C18H19BrClNO2 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1cc(OC)c(OCc2cccc(Cl)c2)cc1Br |
| InChI | InChI=1S/C18H19BrClNO2/c1-3-7-21-11-14-9-17(22-2)18(10-16(14)19)23-12-13-5-4-6-15(20)8-13/h3-6,8-10,21H,1,7,11-12H2,2H3 |
| InChIKey | SAWMSFYKUQNJNZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|