C16H16Br2INO — CID 107742220
N-[[3,5-dibromo-4-[(4-iodophenyl)methoxy]phenyl]methyl]ethanamine (PubChem CID 107742220) has the molecular formula C16H16Br2INO and a molecular weight of 525.02 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-[(4-iodophenyl)methoxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-dibromo-4-[(4-iodophenyl)methoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 107742220 |
| Molecular Formula | C16H16Br2INO |
| Molecular Weight | 525.02 g/mol |
| Exact Mass | 522.86 |
| IUPAC Name | N-[[3,5-dibromo-4-[(4-iodophenyl)methoxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Br)c(OCc2ccc(I)cc2)c(Br)c1 |
| InChI | InChI=1S/C16H16Br2INO/c1-2-20-9-12-7-14(17)16(15(18)8-12)21-10-11-3-5-13(19)6-4-11/h3-8,20H,2,9-10H2,1H3 |
| InChIKey | GSDBDZWHSZRSED-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|