C13H21BrN2O — CID 113410172
N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethylpropane-1,3-diamine (PubChem CID 113410172) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 113410172 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N'-[(3-bromo-4-methoxyphenyl)methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C13H21BrN2O/c1-3-15-7-4-8-16-10-11-5-6-13(17-2)12(14)9-11/h5-6,9,15-16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | XLSWNJCADGWGOF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|