C10H13BrClNO — CID 65026221
N-[(3-bromo-4-methoxyphenyl)methyl]-2-chloroethanamine (PubChem CID 65026221) has the molecular formula C10H13BrClNO and a molecular weight of 278.58 g/mol. Its IUPAC name is N-[(3-bromo-4-methoxyphenyl)methyl]-2-chloroethanamine.
| Compound Name | N-[(3-bromo-4-methoxyphenyl)methyl]-2-chloroethanamine |
|---|---|
| PubChem CID | 65026221 |
| Molecular Formula | C10H13BrClNO |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | N-[(3-bromo-4-methoxyphenyl)methyl]-2-chloroethanamine |
| SMILES | COc1ccc(CNCCCl)cc1Br |
| InChI | InChI=1S/C10H13BrClNO/c1-14-10-3-2-8(6-9(10)11)7-13-5-4-12/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | RANNZNDKEIFFLO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|