C24H23N3O4S — CID 16609928
N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 16609928) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 16609928 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CNS(=O)(=O)Cc1ccc(CNC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-25-32(30,31)16-18-12-10-17(11-13-18)14-26-23(28)15-27-21-8-4-2-6-19(21)24(29)20-7-3-5-9-22(20)27/h2-13,25H,14-16H2,1H3,(H,26,28) |
| InChIKey | HHENARBIMKZVHT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|