C22H17ClN4O3 — CID 133064039
1-(3-chlorophenyl)-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]urea (PubChem CID 133064039) has the molecular formula C22H17ClN4O3 and a molecular weight of 420.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]urea |
|---|---|
| PubChem CID | 133064039 |
| Molecular Formula | C22H17ClN4O3 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]urea |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H17ClN4O3/c23-14-6-5-7-15(12-14)24-22(30)26-25-20(28)13-27-18-10-3-1-8-16(18)21(29)17-9-2-4-11-19(17)27/h1-12H,13H2,(H,25,28)(H2,24,26,30) |
| InChIKey | FACNDSTVTKKROT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|